Pi bon Urolithin B poud (1139-83-9) Manifakti & faktori

Urolithin B. poud

Novanm 9, 2020

Urolitin BSpecifications

Non: Urolitin B
Chimik Non: 3-idroksi-6H-dibenzo [b, d] piran-6-yon sèl
Sèrtifikasyon: 1139-83-9
Fòmil Chimik: C13H8O3
Molekilè Pwa: X
Koulè:  Poud blan
InChi kle: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kòd SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Fonksyon: Urolitin B ka amelyore mitokondriyo ak fonksyon nan misk.

Urolitin B kapab amelyore fòs nan misk ak andirans pandan aje.

Aplikasyon: Urolitin B se yon metabolit entesten mikrobyen nan ellagitannis ak ekspozisyon ki pisan anti-oxidant ak pro-oksidantèl activies depann sou sistèm nan épreuves ak kondisyon yo. Urolitin B kapab tou montre estwojèn ak / oswa aktivite anti-estwojèn.
Solisyon: Fasil soluble nan N, N-dimethylformamide ak dimethylmethylene. Sulfone, yon ti kras soluble nan methanol, etanòl, ak asetat etilik
Tanp Depo: Hygroscopic, -20 ° C frizè, anba atmosfè inaktif
Condition Shipping: Ekri anba tanperati anbyen kòm chimik ki pa danjere. Pwodui sa a estab ase pou kèk semèn pandan anbakman òdinè ak tan ki pase nan Ladwàn.

 

Urolitin B NMR Spectrum

Urolithin B (1139-83-9) - Spectrum NMR

 

Si ou bezwen COA, MSDS, HNMR pou chak pakèt pwodwi ak lòt enfòmasyon, tanpri kontakte nou manadjè maketing.